ChemNet > CAS > 4506-71-2 Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate
4506-71-2 Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate
| اسم المنتج |
Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate |
| الاسم بالانجليزية |
Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate; 2-Amino-3-carbethoxy-4,5-tetramethylenethiophene; Ethyl-2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylat |
| الصيغة الجزيئية |
C11H15NO2S |
| الوزن الجزيئي الغرامي |
225.30 |
| InChI |
InChI=1/C11H15NO2S/c1-2-14-11(13)9-7-5-3-4-6-8(7)15-10(9)12/h2-6,12H2,1H3 |
| إستراتيجية المساعدة القطرية |
4506-71-2 |
| المفوضية الأوروبية رقم |
224-823-1 |
| بنية جزيئية |
![4506-71-2 Ethyl 2-amino-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate](https://images-a.chemnet.com/suppliers/chembase/481/4815.gif)
|
| درجة الإنصهار |
114-117℃ |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
